C27H35BCl2N2O5 — CID 174052256
2,5-dichloro-N-[3-methoxy-1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]benzamide (PubChem CID 174052256) has the molecular formula C27H35BCl2N2O5 and a molecular weight of 549.30 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-methoxy-1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[3-methoxy-1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 174052256 |
| Molecular Formula | C27H35BCl2N2O5 |
| Molecular Weight | 549.30 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 2,5-dichloro-N-[3-methoxy-1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]benzamide |
| SMILES | COCC(NC(=O)c1cc(Cl)ccc1Cl)C(=O)NC(CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H35BCl2N2O5/c1-26(2)27(3,4)37-28(36-26)23(13-9-12-18-10-7-6-8-11-18)32-25(34)22(17-35-5)31-24(33)20-16-19(29)14-15-21(20)30/h6-8,10-11,14-16,22-23H,9,12-13,17H2,1-5H3,(H,31,33)(H,32,34) |
| InChIKey | DWLLJGPETWURBI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|