C27H36BClN2O5 — CID 174051067
3-chloro-N-[3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]benzamide (PubChem CID 174051067) has the molecular formula C27H36BClN2O5 and a molecular weight of 514.86 g/mol. Its IUPAC name is 3-chloro-N-[3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]benzamide.
| Compound Name | 3-chloro-N-[3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 174051067 |
| Molecular Formula | C27H36BClN2O5 |
| Molecular Weight | 514.86 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 3-chloro-N-[3-methoxy-1-oxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]benzamide |
| SMILES | COCC(NC(=O)c1cccc(Cl)c1)C(=O)N[C@@H](CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C27H36BClN2O5/c1-26(2)27(3,4)36-28(35-26)23(16-9-13-19-11-7-6-8-12-19)31-25(33)22(18-34-5)30-24(32)20-14-10-15-21(29)17-20/h6-8,10-12,14-15,17,22-23H,9,13,16,18H2,1-5H3,(H,30,32)(H,31,33)/t22?,23-/m0/s1 |
| InChIKey | JFCSSEAFAGVJEN-WCSIJFPASA-N |
| XLogP | 4.22 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|