C31H40BCl2N3O6 — CID 168919927
2,5-dichloro-N-[(2R)-4-morpholin-4-yl-1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]benzamide (PubChem CID 168919927) has the molecular formula C31H40BCl2N3O6 and a molecular weight of 632.39 g/mol. Its IUPAC name is 2,5-dichloro-N-[(2R)-4-morpholin-4-yl-1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]benzamide.
| Compound Name | 2,5-dichloro-N-[(2R)-4-morpholin-4-yl-1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 168919927 |
| Molecular Formula | C31H40BCl2N3O6 |
| Molecular Weight | 632.39 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 2,5-dichloro-N-[(2R)-4-morpholin-4-yl-1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]benzamide |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)[C@@H](CC(=O)N2CCOCC2)NC(=O)c2cc(Cl)ccc2Cl)OC1(C)C |
| InChI | InChI=1S/C31H40BCl2N3O6/c1-30(2)31(3,4)43-32(42-30)26(12-8-11-21-9-6-5-7-10-21)36-29(40)25(20-27(38)37-15-17-41-18-16-37)35-28(39)23-19-22(33)13-14-24(23)34/h5-7,9-10,13-14,19,25-26H,8,11-12,15-18,20H2,1-4H3,(H,35,39)(H,36,40)/t25-,26+/m1/s1 |
| InChIKey | FWYRBUNPLJLNRG-FTJBHMTQSA-N |
| XLogP | 4.48 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|