C29H46BN3O7 — CID 175893181
butyl N-[(2S)-4-morpholin-4-yl-1,4-dioxo-1-[[(1S)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamate (PubChem CID 175893181) has the molecular formula C29H46BN3O7 and a molecular weight of 559.51 g/mol. Its IUPAC name is butyl N-[(2S)-4-morpholin-4-yl-1,4-dioxo-1-[[(1S)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamate.
| Compound Name | butyl N-[(2S)-4-morpholin-4-yl-1,4-dioxo-1-[[(1S)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 175893181 |
| Molecular Formula | C29H46BN3O7 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 559.34 |
| IUPAC Name | butyl N-[(2S)-4-morpholin-4-yl-1,4-dioxo-1-[[(1S)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]butan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](CC(=O)N1CCOCC1)C(=O)N[C@H](CCCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H46BN3O7/c1-6-7-18-38-27(36)31-23(21-25(34)33-16-19-37-20-17-33)26(35)32-24(15-11-14-22-12-9-8-10-13-22)30-39-28(2,3)29(4,5)40-30/h8-10,12-13,23-24H,6-7,11,14-21H2,1-5H3,(H,31,36)(H,32,35)/t23-,24+/m0/s1 |
| InChIKey | XEQLKSPKOFIZHO-BJKOFHAPSA-N |
| XLogP | 3.27 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|