C31H44BN5O5 — CID 174078817
N-[(2R)-1-[[(1R)-1-(4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4-phenylbutyl]amino]-1,4-dioxo-4-piperidin-1-ylbutan-2-yl]pyrazine-2-carboxamide (PubChem CID 174078817) has the molecular formula C31H44BN5O5 and a molecular weight of 577.54 g/mol. Its IUPAC name is N-[(2R)-1-[[(1R)-1-(4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4-phenylbutyl]amino]-1,4-dioxo-4-piperidin-1-ylbutan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2R)-1-[[(1R)-1-(4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4-phenylbutyl]amino]-1,4-dioxo-4-piperidin-1-ylbutan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174078817 |
| Molecular Formula | C31H44BN5O5 |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.34 |
| IUPAC Name | N-[(2R)-1-[[(1R)-1-(4-ethyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)-4-phenylbutyl]amino]-1,4-dioxo-4-piperidin-1-ylbutan-2-yl]pyrazine-2-carboxamide |
| SMILES | CCC1(C)OB([C@H](CCCc2ccccc2)NC(=O)[C@@H](CC(=O)N2CCCCC2)NC(=O)c2cnccn2)OC1(C)C |
| InChI | InChI=1S/C31H44BN5O5/c1-5-31(4)30(2,3)41-32(42-31)26(16-12-15-23-13-8-6-9-14-23)36-28(39)24(21-27(38)37-19-10-7-11-20-37)35-29(40)25-22-33-17-18-34-25/h6,8-9,13-14,17-18,22,24,26H,5,7,10-12,15-16,19-21H2,1-4H3,(H,35,40)(H,36,39)/t24-,26+,31?/m1/s1 |
| InChIKey | YXRQGPLWRQGQDN-PTJHPHGDSA-N |
| XLogP | 3.51 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|