C30H37BN4O4S — CID 168920046
N-[(2S)-1-oxo-3-phenylsulfanyl-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyrazine-2-carboxamide (PubChem CID 168920046) has the molecular formula C30H37BN4O4S and a molecular weight of 560.53 g/mol. Its IUPAC name is N-[(2S)-1-oxo-3-phenylsulfanyl-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-1-oxo-3-phenylsulfanyl-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 168920046 |
| Molecular Formula | C30H37BN4O4S |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | N-[(2S)-1-oxo-3-phenylsulfanyl-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]propan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)[C@@H](CSc2ccccc2)NC(=O)c2cnccn2)OC1(C)C |
| InChI | InChI=1S/C30H37BN4O4S/c1-29(2)30(3,4)39-31(38-29)26(17-11-14-22-12-7-5-8-13-22)35-28(37)25(21-40-23-15-9-6-10-16-23)34-27(36)24-20-32-18-19-33-24/h5-10,12-13,15-16,18-20,25-26H,11,14,17,21H2,1-4H3,(H,34,36)(H,35,37)/t25-,26+/m1/s1 |
| InChIKey | JGIXKYVQWWHRMJ-FTJBHMTQSA-N |
| XLogP | 4.51 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|