C26H37BN4O6 — CID 174051279
N-[3-methoxy-1-[[(1R)-4-(4-methoxyphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxopropan-2-yl]pyrazine-2-carboxamide (PubChem CID 174051279) has the molecular formula C26H37BN4O6 and a molecular weight of 512.42 g/mol. Its IUPAC name is N-[3-methoxy-1-[[(1R)-4-(4-methoxyphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxopropan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[3-methoxy-1-[[(1R)-4-(4-methoxyphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxopropan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174051279 |
| Molecular Formula | C26H37BN4O6 |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | N-[3-methoxy-1-[[(1R)-4-(4-methoxyphenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-1-oxopropan-2-yl]pyrazine-2-carboxamide |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)N[C@@H](CCCc1ccc(OC)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H37BN4O6/c1-25(2)26(3,4)37-27(36-25)22(9-7-8-18-10-12-19(35-6)13-11-18)31-24(33)21(17-34-5)30-23(32)20-16-28-14-15-29-20/h10-16,21-22H,7-9,17H2,1-6H3,(H,30,32)(H,31,33)/t21?,22-/m0/s1 |
| InChIKey | UFWQNGLXNSCGNX-KEKNWZKVSA-N |
| XLogP | 2.37 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|