C19H24BFN4O5 — CID 174051569
[4-(4-fluorophenyl)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid (PubChem CID 174051569) has the molecular formula C19H24BFN4O5 and a molecular weight of 418.23 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid.
| Compound Name | [4-(4-fluorophenyl)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 174051569 |
| Molecular Formula | C19H24BFN4O5 |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [4-(4-fluorophenyl)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)NC(CCCc1ccc(F)cc1)B(O)O |
| InChI | InChI=1S/C19H24BFN4O5/c1-30-12-16(24-18(26)15-11-22-9-10-23-15)19(27)25-17(20(28)29)4-2-3-13-5-7-14(21)8-6-13/h5-11,16-17,28-29H,2-4,12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | XUNZVQFSIIIWJF-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|