C25H34BFN4O5 — CID 174051539
N-[1-[[4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]pyrazine-2-carboxamide (PubChem CID 174051539) has the molecular formula C25H34BFN4O5 and a molecular weight of 500.38 g/mol. Its IUPAC name is N-[1-[[4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-[[4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174051539 |
| Molecular Formula | C25H34BFN4O5 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | N-[1-[[4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]pyrazine-2-carboxamide |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)NC(CCCc1ccc(F)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H34BFN4O5/c1-24(2)25(3,4)36-26(35-24)21(8-6-7-17-9-11-18(27)12-10-17)31-23(33)20(16-34-5)30-22(32)19-15-28-13-14-29-19/h9-15,20-21H,6-8,16H2,1-5H3,(H,30,32)(H,31,33) |
| InChIKey | XCYIBHHBQBINRH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|