C29H36BN5O5 — CID 174051900
N-[1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-pyridin-2-yloxypropan-2-yl]pyrazine-2-carboxamide (PubChem CID 174051900) has the molecular formula C29H36BN5O5 and a molecular weight of 545.45 g/mol. Its IUPAC name is N-[1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-pyridin-2-yloxypropan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-pyridin-2-yloxypropan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174051900 |
| Molecular Formula | C29H36BN5O5 |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | N-[1-oxo-1-[[4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-pyridin-2-yloxypropan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC1(C)OB(C(CCCc2ccccc2)NC(=O)C(COc2ccccn2)NC(=O)c2cnccn2)OC1(C)C |
| InChI | InChI=1S/C29H36BN5O5/c1-28(2)29(3,4)40-30(39-28)24(14-10-13-21-11-6-5-7-12-21)35-27(37)23(20-38-25-15-8-9-16-33-25)34-26(36)22-19-31-17-18-32-22/h5-9,11-12,15-19,23-24H,10,13-14,20H2,1-4H3,(H,34,36)(H,35,37) |
| InChIKey | MHZZMLNXCXGVAP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|