C26H38BClN2O4 — CID 168920260
(2R)-2-amino-3-phenylmethoxy-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]propanamide;hydrochloride (PubChem CID 168920260) has the molecular formula C26H38BClN2O4 and a molecular weight of 488.87 g/mol. Its IUPAC name is (2R)-2-amino-3-phenylmethoxy-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-3-phenylmethoxy-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 168920260 |
| Molecular Formula | C26H38BClN2O4 |
| Molecular Weight | 488.87 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | (2R)-2-amino-3-phenylmethoxy-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]propanamide;hydrochloride |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)[C@H](N)COCc2ccccc2)OC1(C)C.Cl |
| InChI | InChI=1S/C26H37BN2O4.ClH/c1-25(2)26(3,4)33-27(32-25)23(17-11-16-20-12-7-5-8-13-20)29-24(30)22(28)19-31-18-21-14-9-6-10-15-21;/h5-10,12-15,22-23H,11,16-19,28H2,1-4H3,(H,29,30);1H/t22-,23+;/m1./s1 |
| InChIKey | RPENZMKVWAHWRC-RFPXDPOKSA-N |
| XLogP | 4.09 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.87 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|