C24H39BClN3O5 — CID 168919976
(2S)-2-amino-4-morpholin-4-yl-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide;hydrochloride (PubChem CID 168919976) has the molecular formula C24H39BClN3O5 and a molecular weight of 495.86 g/mol. Its IUPAC name is (2S)-2-amino-4-morpholin-4-yl-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-4-morpholin-4-yl-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 168919976 |
| Molecular Formula | C24H39BClN3O5 |
| Molecular Weight | 495.86 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (2S)-2-amino-4-morpholin-4-yl-4-oxo-N-[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]butanamide;hydrochloride |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)[C@@H](N)CC(=O)N2CCOCC2)OC1(C)C.Cl |
| InChI | InChI=1S/C24H38BN3O5.ClH/c1-23(2)24(3,4)33-25(32-23)20(12-8-11-18-9-6-5-7-10-18)27-22(30)19(26)17-21(29)28-13-15-31-16-14-28;/h5-7,9-10,19-20H,8,11-17,26H2,1-4H3,(H,27,30);1H/t19-,20-;/m0./s1 |
| InChIKey | XWDLTRHKYAQPLI-FKLPMGAJSA-N |
| XLogP | 2.12 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|