C30H42BN5O5 — CID 174052175
N-[1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-4-piperidin-1-ylbutan-2-yl]pyrazine-2-carboxamide (PubChem CID 174052175) has the molecular formula C30H42BN5O5 and a molecular weight of 563.51 g/mol. Its IUPAC name is N-[1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-4-piperidin-1-ylbutan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-4-piperidin-1-ylbutan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174052175 |
| Molecular Formula | C30H42BN5O5 |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | N-[1,4-dioxo-1-[[(1R)-4-phenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-4-piperidin-1-ylbutan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC1(C)OB([C@H](CCCc2ccccc2)NC(=O)C(CC(=O)N2CCCCC2)NC(=O)c2cnccn2)OC1(C)C |
| InChI | InChI=1S/C30H42BN5O5/c1-29(2)30(3,4)41-31(40-29)25(15-11-14-22-12-7-5-8-13-22)35-27(38)23(20-26(37)36-18-9-6-10-19-36)34-28(39)24-21-32-16-17-33-24/h5,7-8,12-13,16-17,21,23,25H,6,9-11,14-15,18-20H2,1-4H3,(H,34,39)(H,35,38)/t23?,25-/m0/s1 |
| InChIKey | HCSRKXMUFUXSLX-YNMFNDETSA-N |
| XLogP | 3.12 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|