C25H35BN6O5 — CID 174052136
[1-[[4-(4-ethylpiperazin-1-yl)-4-oxo-2-(pyrazine-2-carbonylamino)butanoyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 174052136) has the molecular formula C25H35BN6O5 and a molecular weight of 510.40 g/mol. Its IUPAC name is [1-[[4-(4-ethylpiperazin-1-yl)-4-oxo-2-(pyrazine-2-carbonylamino)butanoyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [1-[[4-(4-ethylpiperazin-1-yl)-4-oxo-2-(pyrazine-2-carbonylamino)butanoyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 174052136 |
| Molecular Formula | C25H35BN6O5 |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | [1-[[4-(4-ethylpiperazin-1-yl)-4-oxo-2-(pyrazine-2-carbonylamino)butanoyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | CCN1CCN(C(=O)CC(NC(=O)c2cnccn2)C(=O)NC(CCCc2ccccc2)B(O)O)CC1 |
| InChI | InChI=1S/C25H35BN6O5/c1-2-31-13-15-32(16-14-31)23(33)17-20(29-25(35)21-18-27-11-12-28-21)24(34)30-22(26(36)37)10-6-9-19-7-4-3-5-8-19/h3-5,7-8,11-12,18,20,22,36-37H,2,6,9-10,13-17H2,1H3,(H,29,35)(H,30,34) |
| InChIKey | AMAACFZVRQMWJZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|