C18H23BN4O6 — CID 174051867
[(1R)-4-(4-hydroxyphenyl)-1-[[3-hydroxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid (PubChem CID 174051867) has the molecular formula C18H23BN4O6 and a molecular weight of 402.22 g/mol. Its IUPAC name is [(1R)-4-(4-hydroxyphenyl)-1-[[3-hydroxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-4-(4-hydroxyphenyl)-1-[[3-hydroxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 174051867 |
| Molecular Formula | C18H23BN4O6 |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(1R)-4-(4-hydroxyphenyl)-1-[[3-hydroxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
| SMILES | O=C(NC(CO)C(=O)N[C@@H](CCCc1ccc(O)cc1)B(O)O)c1cnccn1 |
| InChI | InChI=1S/C18H23BN4O6/c24-11-15(22-17(26)14-10-20-8-9-21-14)18(27)23-16(19(28)29)3-1-2-12-4-6-13(25)7-5-12/h4-10,15-16,24-25,28-29H,1-3,11H2,(H,22,26)(H,23,27)/t15?,16-/m0/s1 |
| InChIKey | JCGVOBBTVSBDCD-LYKKTTPLSA-N |
| XLogP | -1.21 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|