C19H25BN4O5 — CID 174051799
[1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid (PubChem CID 174051799) has the molecular formula C19H25BN4O5 and a molecular weight of 400.24 g/mol. Its IUPAC name is [1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid.
| Compound Name | [1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid |
|---|---|
| PubChem CID | 174051799 |
| Molecular Formula | C19H25BN4O5 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]-4-phenylbutyl]boronic acid |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)NC(CCCc1ccccc1)B(O)O |
| InChI | InChI=1S/C19H25BN4O5/c1-29-13-16(23-18(25)15-12-21-10-11-22-15)19(26)24-17(20(27)28)9-5-8-14-6-3-2-4-7-14/h2-4,6-7,10-12,16-17,27-28H,5,8-9,13H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | XNDVDZVALTXULW-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|