C18H21BClFN4O6 — CID 174050911
[3-(4-chloro-3-fluorophenoxy)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]propyl]boronic acid (PubChem CID 174050911) has the molecular formula C18H21BClFN4O6 and a molecular weight of 454.65 g/mol. Its IUPAC name is [3-(4-chloro-3-fluorophenoxy)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]propyl]boronic acid.
| Compound Name | [3-(4-chloro-3-fluorophenoxy)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]propyl]boronic acid |
|---|---|
| PubChem CID | 174050911 |
| Molecular Formula | C18H21BClFN4O6 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [3-(4-chloro-3-fluorophenoxy)-1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]propyl]boronic acid |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)NC(CCOc1ccc(Cl)c(F)c1)B(O)O |
| InChI | InChI=1S/C18H21BClFN4O6/c1-30-10-15(24-17(26)14-9-22-5-6-23-14)18(27)25-16(19(28)29)4-7-31-11-2-3-12(20)13(21)8-11/h2-3,5-6,8-9,15-16,28-29H,4,7,10H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | ADHFRIDYOXVIBO-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|