C16H19N3O3 — CID 124854277
N-[(1R)-1-(4-ethoxyphenyl)-2-methoxyethyl]pyrazine-2-carboxamide (PubChem CID 124854277) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethoxyphenyl)-2-methoxyethyl]pyrazine-2-carboxamide.
| Compound Name | N-[(1R)-1-(4-ethoxyphenyl)-2-methoxyethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 124854277 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[(1R)-1-(4-ethoxyphenyl)-2-methoxyethyl]pyrazine-2-carboxamide |
| SMILES | CCOc1ccc([C@H](COC)NC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-3-22-13-6-4-12(5-7-13)15(11-21-2)19-16(20)14-10-17-8-9-18-14/h4-10,15H,3,11H2,1-2H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | WXLWUCLXXAZAPC-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |