C11H17BN4O5 — CID 168920116
1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]ethylboronic acid (PubChem CID 168920116) has the molecular formula C11H17BN4O5 and a molecular weight of 296.09 g/mol. Its IUPAC name is 1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]ethylboronic acid.
| Compound Name | 1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]ethylboronic acid |
|---|---|
| PubChem CID | 168920116 |
| Molecular Formula | C11H17BN4O5 |
| Molecular Weight | 296.09 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-[[3-methoxy-2-(pyrazine-2-carbonylamino)propanoyl]amino]ethylboronic acid |
| SMILES | COCC(NC(=O)c1cnccn1)C(=O)NC(C)B(O)O |
| InChI | InChI=1S/C11H17BN4O5/c1-7(12(19)20)15-11(18)9(6-21-2)16-10(17)8-5-13-3-4-14-8/h3-5,7,9,19-20H,6H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | WATHMNPXLMHCID-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.09 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|