C17H25BN6O4 — CID 174052212
[(1R)-3-methyl-1-[[3-(1-methylimidazol-2-yl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid (PubChem CID 174052212) has the molecular formula C17H25BN6O4 and a molecular weight of 388.24 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[3-(1-methylimidazol-2-yl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[3-(1-methylimidazol-2-yl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 174052212 |
| Molecular Formula | C17H25BN6O4 |
| Molecular Weight | 388.24 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [(1R)-3-methyl-1-[[3-(1-methylimidazol-2-yl)-2-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)C(Cc1nccn1C)NC(=O)c1cnccn1)B(O)O |
| InChI | InChI=1S/C17H25BN6O4/c1-11(2)8-14(18(27)28)23-16(25)12(9-15-21-6-7-24(15)3)22-17(26)13-10-19-4-5-20-13/h4-7,10-12,14,27-28H,8-9H2,1-3H3,(H,22,26)(H,23,25)/t12?,14-/m0/s1 |
| InChIKey | VRMHUSYXNDNDGM-PYMCNQPYSA-N |
| XLogP | -0.91 |
| TPSA | 142.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|