C15H25BN4O4 — CID 74767136
[(1R)-3-methyl-1-[[(2R)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]butyl]boronic acid (PubChem CID 74767136) has the molecular formula C15H25BN4O4 and a molecular weight of 336.20 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2R)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2R)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 74767136 |
| Molecular Formula | C15H25BN4O4 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2R)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](NC(=O)c1cnccn1)C(C)C)B(O)O |
| InChI | InChI=1S/C15H25BN4O4/c1-9(2)7-12(16(23)24)19-15(22)13(10(3)4)20-14(21)11-8-17-5-6-18-11/h5-6,8-10,12-13,23-24H,7H2,1-4H3,(H,19,22)(H,20,21)/t12-,13+/m0/s1 |
| InChIKey | NJZWEXIMVOHJRW-QWHCGFSZSA-N |
| XLogP | -0.23 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|