C16H22N4O4 — CID 163739620
methyl 3-methyl-2-[[(2S)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]but-2-enoate (PubChem CID 163739620) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 3-methyl-2-[[(2S)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]but-2-enoate.
| Compound Name | methyl 3-methyl-2-[[(2S)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 163739620 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | methyl 3-methyl-2-[[(2S)-3-methyl-2-(pyrazine-2-carbonylamino)butanoyl]amino]but-2-enoate |
| SMILES | COC(=O)C(NC(=O)[C@@H](NC(=O)c1cnccn1)C(C)C)=C(C)C |
| InChI | InChI=1S/C16H22N4O4/c1-9(2)12(19-14(21)11-8-17-6-7-18-11)15(22)20-13(10(3)4)16(23)24-5/h6-9,12H,1-5H3,(H,19,21)(H,20,22)/t12-/m0/s1 |
| InChIKey | LGQCPSMRNOKISR-LBPRGKRZSA-N |
| XLogP | 0.81 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|