C20H27BN4O4 — CID 45139393
[(1R)-3-methyl-1-[[3-(4-methylphenyl)-3-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid (PubChem CID 45139393) has the molecular formula C20H27BN4O4 and a molecular weight of 398.27 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[3-(4-methylphenyl)-3-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[3-(4-methylphenyl)-3-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 45139393 |
| Molecular Formula | C20H27BN4O4 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [(1R)-3-methyl-1-[[3-(4-methylphenyl)-3-(pyrazine-2-carbonylamino)propanoyl]amino]butyl]boronic acid |
| SMILES | Cc1ccc(C(CC(=O)N[C@@H](CC(C)C)B(O)O)NC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C20H27BN4O4/c1-13(2)10-18(21(28)29)25-19(26)11-16(15-6-4-14(3)5-7-15)24-20(27)17-12-22-8-9-23-17/h4-9,12-13,16,18,28-29H,10-11H2,1-3H3,(H,24,27)(H,25,26)/t16?,18-/m0/s1 |
| InChIKey | WXSNSXSTOXJAHD-DAFXYXGESA-N |
| XLogP | 1.19 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|