C21H26BFN2O4 — CID 75307019
[1-[[3-benzamido-3-(4-fluorophenyl)propanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 75307019) has the molecular formula C21H26BFN2O4 and a molecular weight of 400.26 g/mol. Its IUPAC name is [1-[[3-benzamido-3-(4-fluorophenyl)propanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [1-[[3-benzamido-3-(4-fluorophenyl)propanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 75307019 |
| Molecular Formula | C21H26BFN2O4 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [1-[[3-benzamido-3-(4-fluorophenyl)propanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)CC(NC(=O)CC(NC(=O)c1ccccc1)c1ccc(F)cc1)B(O)O |
| InChI | InChI=1S/C21H26BFN2O4/c1-14(2)12-19(22(28)29)25-20(26)13-18(15-8-10-17(23)11-9-15)24-21(27)16-6-4-3-5-7-16/h3-11,14,18-19,28-29H,12-13H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | JYNZVDKPISYXEK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|