C22H26N2O4 — CID 119188451
2-[(3-benzamido-3-phenylpropanoyl)amino]-4-methylpentanoic acid (PubChem CID 119188451) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[(3-benzamido-3-phenylpropanoyl)amino]-4-methylpentanoic acid.
| Compound Name | 2-[(3-benzamido-3-phenylpropanoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119188451 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-[(3-benzamido-3-phenylpropanoyl)amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)CC(NC(=O)c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H26N2O4/c1-15(2)13-19(22(27)28)23-20(25)14-18(16-9-5-3-6-10-16)24-21(26)17-11-7-4-8-12-17/h3-12,15,18-19H,13-14H2,1-2H3,(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | PWFQOKCWWPHBBI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |