C18H26N2O4 — CID 119188374
2-[[3-acetamido-3-(4-methylphenyl)propanoyl]amino]-4-methylpentanoic acid (PubChem CID 119188374) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[[3-acetamido-3-(4-methylphenyl)propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[3-acetamido-3-(4-methylphenyl)propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119188374 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-[[3-acetamido-3-(4-methylphenyl)propanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(=O)NC(CC(=O)NC(CC(C)C)C(=O)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-11(2)9-16(18(23)24)20-17(22)10-15(19-13(4)21)14-7-5-12(3)6-8-14/h5-8,11,15-16H,9-10H2,1-4H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | HXJIBWXFMZTPMJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |