C26H37BN4O5 — CID 146983323
[(1R)-1-[[(2R,5S)-2-benzyl-7-methyl-4-oxo-5-(pyrazine-2-carbonylamino)octanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 146983323) has the molecular formula C26H37BN4O5 and a molecular weight of 496.42 g/mol. Its IUPAC name is [(1R)-1-[[(2R,5S)-2-benzyl-7-methyl-4-oxo-5-(pyrazine-2-carbonylamino)octanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2R,5S)-2-benzyl-7-methyl-4-oxo-5-(pyrazine-2-carbonylamino)octanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 146983323 |
| Molecular Formula | C26H37BN4O5 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | [(1R)-1-[[(2R,5S)-2-benzyl-7-methyl-4-oxo-5-(pyrazine-2-carbonylamino)octanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)Cc1ccccc1)B(O)O |
| InChI | InChI=1S/C26H37BN4O5/c1-17(2)12-21(30-26(34)22-16-28-10-11-29-22)23(32)15-20(14-19-8-6-5-7-9-19)25(33)31-24(27(35)36)13-18(3)4/h5-11,16-18,20-21,24,35-36H,12-15H2,1-4H3,(H,30,34)(H,31,33)/t20-,21+,24+/m1/s1 |
| InChIKey | AOTAZAHSIWIVQA-DPLHUUCSSA-N |
| XLogP | 1.98 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|