C22H32BN3O5Si — CID 157226122
[(4R,7S)-8-[4-[hydroxy(dimethyl)silyl]phenyl]-2-methyl-6-oxo-7-(pyrazine-2-carbonylamino)octan-4-yl]boronic acid (PubChem CID 157226122) has the molecular formula C22H32BN3O5Si and a molecular weight of 457.41 g/mol. Its IUPAC name is [(4R,7S)-8-[4-[hydroxy(dimethyl)silyl]phenyl]-2-methyl-6-oxo-7-(pyrazine-2-carbonylamino)octan-4-yl]boronic acid.
| Compound Name | [(4R,7S)-8-[4-[hydroxy(dimethyl)silyl]phenyl]-2-methyl-6-oxo-7-(pyrazine-2-carbonylamino)octan-4-yl]boronic acid |
|---|---|
| PubChem CID | 157226122 |
| Molecular Formula | C22H32BN3O5Si |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | [(4R,7S)-8-[4-[hydroxy(dimethyl)silyl]phenyl]-2-methyl-6-oxo-7-(pyrazine-2-carbonylamino)octan-4-yl]boronic acid |
| SMILES | CC(C)CC(CC(=O)[C@H](Cc1ccc([Si](C)(C)O)cc1)NC(=O)c1cnccn1)B(O)O |
| InChI | InChI=1S/C22H32BN3O5Si/c1-15(2)11-17(23(29)30)13-21(27)19(26-22(28)20-14-24-9-10-25-20)12-16-5-7-18(8-6-16)32(3,4)31/h5-10,14-15,17,19,29-31H,11-13H2,1-4H3,(H,26,28)/t17?,19-/m0/s1 |
| InChIKey | QRNPDERCWMDOOE-NNBQYGFHSA-N |
| XLogP | 1.07 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|