C26H36BN3O4 — CID 160799138
N-[(2S,5R)-7-methyl-3-oxo-1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octan-2-yl]pyrazine-2-carboxamide (PubChem CID 160799138) has the molecular formula C26H36BN3O4 and a molecular weight of 465.40 g/mol. Its IUPAC name is N-[(2S,5R)-7-methyl-3-oxo-1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S,5R)-7-methyl-3-oxo-1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 160799138 |
| Molecular Formula | C26H36BN3O4 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | N-[(2S,5R)-7-methyl-3-oxo-1-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)octan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@H](CC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H36BN3O4/c1-18(2)14-20(27-33-25(3,4)26(5,6)34-27)16-23(31)21(15-19-10-8-7-9-11-19)30-24(32)22-17-28-12-13-29-22/h7-13,17-18,20-21H,14-16H2,1-6H3,(H,30,32)/t20-,21+/m1/s1 |
| InChIKey | LNDKGMGHXITXQS-RTWAWAEBSA-N |
| XLogP | 4.29 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|