C30H40BN3O4 — CID 159222418
N-[(2S)-7-methyl-3-oxo-1-phenyl-5-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]octan-2-yl]pyrazine-2-carboxamide (PubChem CID 159222418) has the molecular formula C30H40BN3O4 and a molecular weight of 517.48 g/mol. Its IUPAC name is N-[(2S)-7-methyl-3-oxo-1-phenyl-5-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]octan-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[(2S)-7-methyl-3-oxo-1-phenyl-5-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]octan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 159222418 |
| Molecular Formula | C30H40BN3O4 |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | N-[(2S)-7-methyl-3-oxo-1-phenyl-5-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]octan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)CC(CC(=O)[C@H](Cc1ccccc1)NC(=O)c1cnccn1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C30H40BN3O4/c1-19(2)13-22(31-37-27-16-21-15-26(29(21,3)4)30(27,5)38-31)17-25(35)23(14-20-9-7-6-8-10-20)34-28(36)24-18-32-11-12-33-24/h6-12,18-19,21-23,26-27H,13-17H2,1-5H3,(H,34,36)/t21-,22?,23-,26-,27+,30-/m0/s1 |
| InChIKey | KRWBGTIYTJFJMA-YFTJHHLPSA-N |
| XLogP | 4.92 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|