C29H40BN5O4 — CID 153052981
(2S)-2-[[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoylamino]-3-phenyl-N-pyrazin-2-ylpropanamide (PubChem CID 153052981) has the molecular formula C29H40BN5O4 and a molecular weight of 533.48 g/mol. Its IUPAC name is (2S)-2-[[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoylamino]-3-phenyl-N-pyrazin-2-ylpropanamide.
| Compound Name | (2S)-2-[[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoylamino]-3-phenyl-N-pyrazin-2-ylpropanamide |
|---|---|
| PubChem CID | 153052981 |
| Molecular Formula | C29H40BN5O4 |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.32 |
| IUPAC Name | (2S)-2-[[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]carbamoylamino]-3-phenyl-N-pyrazin-2-ylpropanamide |
| SMILES | CC(C)C[C@H](NC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1cnccn1)B1OC2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C29H40BN5O4/c1-18(2)13-24(30-38-23-16-20-15-22(28(20,3)4)29(23,5)39-30)34-27(37)33-21(14-19-9-7-6-8-10-19)26(36)35-25-17-31-11-12-32-25/h6-12,17-18,20-24H,13-16H2,1-5H3,(H,32,35,36)(H2,33,34,37)/t20-,21+,22-,23?,24+,29-/m1/s1 |
| InChIKey | VHXWHKNHYWBLPN-RCGNMBLLSA-N |
| XLogP | 4.01 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|