C24H36BNO4 — CID 90046288
(2S)-2-[[(1S)-3-methyl-1-[(1S,2S,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-phenylpropanoic acid (PubChem CID 90046288) has the molecular formula C24H36BNO4 and a molecular weight of 413.37 g/mol. Its IUPAC name is (2S)-2-[[(1S)-3-methyl-1-[(1S,2S,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(1S)-3-methyl-1-[(1S,2S,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 90046288 |
| Molecular Formula | C24H36BNO4 |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (2S)-2-[[(1S)-3-methyl-1-[(1S,2S,6S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@@H](N[C@@H](Cc1ccccc1)C(=O)O)B1O[C@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C24H36BNO4/c1-15(2)11-21(26-18(22(27)28)12-16-9-7-6-8-10-16)25-29-20-14-17-13-19(23(17,3)4)24(20,5)30-25/h6-10,15,17-21,26H,11-14H2,1-5H3,(H,27,28)/t17-,18-,19-,20-,21+,24-/m0/s1 |
| InChIKey | AGHSALXJNIGXFI-WNHXVKDHSA-N |
| XLogP | 3.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|