C29H45BN2O4 — CID 174065318
(2S)-2-(2-methylpropanoylamino)-N-[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-phenylbutanamide (PubChem CID 174065318) has the molecular formula C29H45BN2O4 and a molecular weight of 496.50 g/mol. Its IUPAC name is (2S)-2-(2-methylpropanoylamino)-N-[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-phenylbutanamide.
| Compound Name | (2S)-2-(2-methylpropanoylamino)-N-[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 174065318 |
| Molecular Formula | C29H45BN2O4 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.35 |
| IUPAC Name | (2S)-2-(2-methylpropanoylamino)-N-[(1R)-3-methyl-1-[(1R,2R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-phenylbutanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCc1ccccc1)NC(=O)C(C)C)B1OC2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C29H45BN2O4/c1-18(2)15-25(30-35-24-17-21-16-23(28(21,5)6)29(24,7)36-30)32-27(34)22(31-26(33)19(3)4)14-13-20-11-9-8-10-12-20/h8-12,18-19,21-25H,13-17H2,1-7H3,(H,31,33)(H,32,34)/t21-,22+,23-,24?,25+,29-/m1/s1 |
| InChIKey | FROYFHMLNJMDPP-IYDCDERLSA-N |
| XLogP | 4.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|