C18H33BN2O3 — CID 53362152
(2S)-2-amino-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide (PubChem CID 53362152) has the molecular formula C18H33BN2O3 and a molecular weight of 336.29 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide.
| Compound Name | (2S)-2-amino-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
|---|---|
| PubChem CID | 53362152 |
| Molecular Formula | C18H33BN2O3 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | (2S)-2-amino-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)N)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C18H33BN2O3/c1-10(2)7-15(21-16(22)11(3)20)19-23-14-9-12-8-13(17(12,4)5)18(14,6)24-19/h10-15H,7-9,20H2,1-6H3,(H,21,22)/t11-,12-,13-,14+,15-,18-/m0/s1 |
| InChIKey | PELCZTYTDDXCAC-ZOTZHQQFSA-N |
| XLogP | 2.13 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|