C23H41BClN3O5 — CID 174052364
2-amino-N-[3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride (PubChem CID 174052364) has the molecular formula C23H41BClN3O5 and a molecular weight of 485.86 g/mol. Its IUPAC name is 2-amino-N-[3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride.
| Compound Name | 2-amino-N-[3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 174052364 |
| Molecular Formula | C23H41BClN3O5 |
| Molecular Weight | 485.86 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 2-amino-N-[3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-morpholin-4-yl-4-oxobutanamide;hydrochloride |
| SMILES | CC(C)CC(NC(=O)C(N)CC(=O)N1CCOCC1)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1.Cl |
| InChI | InChI=1S/C23H40BN3O5.ClH/c1-14(2)10-19(26-21(29)16(25)13-20(28)27-6-8-30-9-7-27)24-31-18-12-15-11-17(22(15,3)4)23(18,5)32-24;/h14-19H,6-13,25H2,1-5H3,(H,26,29);1H/t15-,16?,17-,18+,19?,23-;/m0./s1 |
| InChIKey | HNQUHVWBSWSRTM-GLTRQQGVSA-N |
| XLogP | 1.78 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.86 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|