C19H34BNO4 — CID 70323395
(3R)-3-hydroxy-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanamide (PubChem CID 70323395) has the molecular formula C19H34BNO4 and a molecular weight of 351.30 g/mol. Its IUPAC name is (3R)-3-hydroxy-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanamide.
| Compound Name | (3R)-3-hydroxy-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanamide |
|---|---|
| PubChem CID | 70323395 |
| Molecular Formula | C19H34BNO4 |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | (3R)-3-hydroxy-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]butanamide |
| SMILES | CC(C)C[C@H](NC(=O)C[C@@H](C)O)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C19H34BNO4/c1-11(2)7-16(21-17(23)8-12(3)22)20-24-15-10-13-9-14(18(13,4)5)19(15,6)25-20/h11-16,22H,7-10H2,1-6H3,(H,21,23)/t12-,13+,14+,15-,16+,19+/m1/s1 |
| InChIKey | GFTRBKFIAGJIFP-MSWPAXRKSA-N |
| XLogP | 2.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|