C19H36BN3O5S — CID 70337234
(2S)-2-amino-3-(methanesulfonamido)-N-[(1R)-3-methyl-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide (PubChem CID 70337234) has the molecular formula C19H36BN3O5S and a molecular weight of 429.39 g/mol. Its IUPAC name is (2S)-2-amino-3-(methanesulfonamido)-N-[(1R)-3-methyl-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide.
| Compound Name | (2S)-2-amino-3-(methanesulfonamido)-N-[(1R)-3-methyl-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
|---|---|
| PubChem CID | 70337234 |
| Molecular Formula | C19H36BN3O5S |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | (2S)-2-amino-3-(methanesulfonamido)-N-[(1R)-3-methyl-1-[(1S,2S,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]propanamide |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CNS(C)(=O)=O)B1OC2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C19H36BN3O5S/c1-11(2)7-16(23-17(24)13(21)10-22-29(6,25)26)20-27-15-9-12-8-14(18(12,3)4)19(15,5)28-20/h11-16,22H,7-10,21H2,1-6H3,(H,23,24)/t12-,13-,14-,15?,16-,19-/m0/s1 |
| InChIKey | MMHCBSPZHNDQBE-ZCBSRUMOSA-N |
| XLogP | 0.66 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|