C24H44BN3O7S — CID 70338063
tert-butyl N-[(2S)-3-(methanesulfonamido)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 70338063) has the molecular formula C24H44BN3O7S and a molecular weight of 529.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-(methanesulfonamido)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-(methanesulfonamido)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70338063 |
| Molecular Formula | C24H44BN3O7S |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | tert-butyl N-[(2S)-3-(methanesulfonamido)-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CNS(C)(=O)=O)NC(=O)OC(C)(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C24H44BN3O7S/c1-14(2)10-19(25-34-18-12-15-11-17(23(15,6)7)24(18,8)35-25)28-20(29)16(13-26-36(9,31)32)27-21(30)33-22(3,4)5/h14-19,26H,10-13H2,1-9H3,(H,27,30)(H,28,29)/t15-,16-,17-,18+,19-,24-/m0/s1 |
| InChIKey | RFANULFNXRJLKD-FPTCARLDSA-N |
| XLogP | 2.23 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|