C22H39BN2O5 — CID 67365548
tert-butyl-[2-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-2-oxoethyl]carbamic acid (PubChem CID 67365548) has the molecular formula C22H39BN2O5 and a molecular weight of 422.38 g/mol. Its IUPAC name is tert-butyl-[2-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-2-oxoethyl]carbamic acid.
| Compound Name | tert-butyl-[2-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 67365548 |
| Molecular Formula | C22H39BN2O5 |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | tert-butyl-[2-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-2-oxoethyl]carbamic acid |
| SMILES | CC(C)C[C@H](NC(=O)CN(C(=O)O)C(C)(C)C)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C22H39BN2O5/c1-13(2)9-17(24-18(26)12-25(19(27)28)20(3,4)5)23-29-16-11-14-10-15(21(14,6)7)22(16,8)30-23/h13-17H,9-12H2,1-8H3,(H,24,26)(H,27,28)/t14-,15-,16+,17-,22-/m0/s1 |
| InChIKey | IAVGCAXKENQYRY-FVMGUFKOSA-N |
| XLogP | 3.56 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|