C21H35BN2O4 — CID 68771244
1-acetamido-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]cyclopropane-1-carboxamide (PubChem CID 68771244) has the molecular formula C21H35BN2O4 and a molecular weight of 390.33 g/mol. Its IUPAC name is 1-acetamido-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]cyclopropane-1-carboxamide.
| Compound Name | 1-acetamido-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 68771244 |
| Molecular Formula | C21H35BN2O4 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 1-acetamido-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]cyclopropane-1-carboxamide |
| SMILES | CC(=O)NC1(C(=O)N[C@@H](CC(C)C)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)CC1 |
| InChI | InChI=1S/C21H35BN2O4/c1-12(2)9-17(23-18(26)21(7-8-21)24-13(3)25)22-27-16-11-14-10-15(19(14,4)5)20(16,6)28-22/h12,14-17H,7-11H2,1-6H3,(H,23,26)(H,24,25)/t14-,15-,16+,17-,20-/m0/s1 |
| InChIKey | TXCPHNJVEJZWNC-GHHWKCCRSA-N |
| XLogP | 2.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|