C29H47BClN3O4 — CID 162339661
N-[(2S)-3-amino-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]-4-butylbenzamide;hydrochloride (PubChem CID 162339661) has the molecular formula C29H47BClN3O4 and a molecular weight of 547.98 g/mol. Its IUPAC name is N-[(2S)-3-amino-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]-4-butylbenzamide;hydrochloride.
| Compound Name | N-[(2S)-3-amino-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]-4-butylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 162339661 |
| Molecular Formula | C29H47BClN3O4 |
| Molecular Weight | 547.98 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | N-[(2S)-3-amino-1-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-1-oxopropan-2-yl]-4-butylbenzamide;hydrochloride |
| SMILES | CCCCc1ccc(C(=O)N[C@@H](CN)C(=O)N[C@@H](CC(C)C)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc1.Cl |
| InChI | InChI=1S/C29H46BN3O4.ClH/c1-7-8-9-19-10-12-20(13-11-19)26(34)32-22(17-31)27(35)33-25(14-18(2)3)30-36-24-16-21-15-23(28(21,4)5)29(24,6)37-30;/h10-13,18,21-25H,7-9,14-17,31H2,1-6H3,(H,32,34)(H,33,35);1H/t21-,22-,23-,24+,25-,29-;/m0./s1 |
| InChIKey | JXKGRNYJEAGCDF-WCTSIEICSA-N |
| XLogP | 4.31 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.98 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|