C37H52BN3O5 — CID 68534131
N-[(2R)-2-[(4-butylbenzoyl)amino]-3-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]-4-methylbenzamide (PubChem CID 68534131) has the molecular formula C37H52BN3O5 and a molecular weight of 629.65 g/mol. Its IUPAC name is N-[(2R)-2-[(4-butylbenzoyl)amino]-3-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]-4-methylbenzamide.
| Compound Name | N-[(2R)-2-[(4-butylbenzoyl)amino]-3-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 68534131 |
| Molecular Formula | C37H52BN3O5 |
| Molecular Weight | 629.65 g/mol |
| Exact Mass | 629.40 |
| IUPAC Name | N-[(2R)-2-[(4-butylbenzoyl)amino]-3-[[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]amino]-3-oxopropyl]-4-methylbenzamide |
| SMILES | CCCCc1ccc(C(=O)N[C@H](CNC(=O)c2ccc(C)cc2)C(=O)N[C@@H](CC(C)C)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc1 |
| InChI | InChI=1S/C37H52BN3O5/c1-8-9-10-25-13-17-27(18-14-25)34(43)40-29(22-39-33(42)26-15-11-24(4)12-16-26)35(44)41-32(19-23(2)3)38-45-31-21-28-20-30(36(28,5)6)37(31,7)46-38/h11-18,23,28-32H,8-10,19-22H2,1-7H3,(H,39,42)(H,40,43)(H,41,44)/t28-,29+,30-,31+,32-,37-/m0/s1 |
| InChIKey | DYMSYZSRWAUMEJ-KKPDPHGCSA-N |
| XLogP | 5.66 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|