C33H52BN3O5 — CID 123273193
(2R)-2-[2-(4-butylphenyl)-2-oxoethyl]-5-(carbamoylamino)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide (PubChem CID 123273193) has the molecular formula C33H52BN3O5 and a molecular weight of 581.61 g/mol. Its IUPAC name is (2R)-2-[2-(4-butylphenyl)-2-oxoethyl]-5-(carbamoylamino)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide.
| Compound Name | (2R)-2-[2-(4-butylphenyl)-2-oxoethyl]-5-(carbamoylamino)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide |
|---|---|
| PubChem CID | 123273193 |
| Molecular Formula | C33H52BN3O5 |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.40 |
| IUPAC Name | (2R)-2-[2-(4-butylphenyl)-2-oxoethyl]-5-(carbamoylamino)-N-[(1R)-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide |
| SMILES | CCCCc1ccc(C(=O)C[C@@H](CCCNC(N)=O)C(=O)N[C@@H](CC(C)C)B2O[C@@H]3C[C@@H]4C[C@@H](C4(C)C)[C@]3(C)O2)cc1 |
| InChI | InChI=1S/C33H52BN3O5/c1-7-8-10-22-12-14-23(15-13-22)26(38)18-24(11-9-16-36-31(35)40)30(39)37-29(17-21(2)3)34-41-28-20-25-19-27(32(25,4)5)33(28,6)42-34/h12-15,21,24-25,27-29H,7-11,16-20H2,1-6H3,(H,37,39)(H3,35,36,40)/t24-,25+,27+,28-,29+,33+/m1/s1 |
| InChIKey | FEFZJIIAGRGXDD-USERSOIWSA-N |
| XLogP | 5.47 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|