C31H49BN2O6S — CID 58301665
(2S)-4-(4-butylphenyl)-2-(methanesulfonamidomethyl)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxobutanamide (PubChem CID 58301665) has the molecular formula C31H49BN2O6S and a molecular weight of 588.62 g/mol. Its IUPAC name is (2S)-4-(4-butylphenyl)-2-(methanesulfonamidomethyl)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxobutanamide.
| Compound Name | (2S)-4-(4-butylphenyl)-2-(methanesulfonamidomethyl)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 58301665 |
| Molecular Formula | C31H49BN2O6S |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | (2S)-4-(4-butylphenyl)-2-(methanesulfonamidomethyl)-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]-4-oxobutanamide |
| SMILES | CCCCc1ccc(C(=O)C[C@@H](CNS(C)(=O)=O)C(=O)N[C@@H](CC(C)C)B2O[C@@H]3C[C@H]4C[C@H](C4(C)C)[C@]3(C)O2)cc1 |
| InChI | InChI=1S/C31H49BN2O6S/c1-8-9-10-21-11-13-22(14-12-21)25(35)16-23(19-33-41(7,37)38)29(36)34-28(15-20(2)3)32-39-27-18-24-17-26(30(24,4)5)31(27,6)40-32/h11-14,20,23-24,26-28,33H,8-10,15-19H2,1-7H3,(H,34,36)/t23-,24+,26+,27+,28-,31-/m0/s1 |
| InChIKey | FUNYUIPAPZFZJT-QVPNYVGVSA-N |
| XLogP | 4.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|