C21H35BN2O6S — CID 58301973
[(1R)-1-[[(2S)-4-(4-butylphenyl)-2-(methanesulfonamidomethyl)-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301973) has the molecular formula C21H35BN2O6S and a molecular weight of 454.40 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-4-(4-butylphenyl)-2-(methanesulfonamidomethyl)-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-4-(4-butylphenyl)-2-(methanesulfonamidomethyl)-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301973 |
| Molecular Formula | C21H35BN2O6S |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | [(1R)-1-[[(2S)-4-(4-butylphenyl)-2-(methanesulfonamidomethyl)-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CCCCc1ccc(C(=O)C[C@@H](CNS(C)(=O)=O)C(=O)N[C@@H](CC(C)C)B(O)O)cc1 |
| InChI | InChI=1S/C21H35BN2O6S/c1-5-6-7-16-8-10-17(11-9-16)19(25)13-18(14-23-31(4,29)30)21(26)24-20(22(27)28)12-15(2)3/h8-11,15,18,20,23,27-28H,5-7,12-14H2,1-4H3,(H,24,26)/t18-,20-/m0/s1 |
| InChIKey | BDXNWOPXKVULCF-ICSRJNTNSA-N |
| XLogP | 1.31 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|