C20H33BN2O6 — CID 142779704
[(1R)-1-[[(2S,3R)-2-[(4-butylbenzoyl)amino]-3-hydroxybutanoyl]amino]-3-methylbutoxy]boronic acid (PubChem CID 142779704) has the molecular formula C20H33BN2O6 and a molecular weight of 408.30 g/mol. Its IUPAC name is [(1R)-1-[[(2S,3R)-2-[(4-butylbenzoyl)amino]-3-hydroxybutanoyl]amino]-3-methylbutoxy]boronic acid.
| Compound Name | [(1R)-1-[[(2S,3R)-2-[(4-butylbenzoyl)amino]-3-hydroxybutanoyl]amino]-3-methylbutoxy]boronic acid |
|---|---|
| PubChem CID | 142779704 |
| Molecular Formula | C20H33BN2O6 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [(1R)-1-[[(2S,3R)-2-[(4-butylbenzoyl)amino]-3-hydroxybutanoyl]amino]-3-methylbutoxy]boronic acid |
| SMILES | CCCCc1ccc(C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)OB(O)O)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C20H33BN2O6/c1-5-6-7-15-8-10-16(11-9-15)19(25)23-18(14(4)24)20(26)22-17(12-13(2)3)29-21(27)28/h8-11,13-14,17-18,24,27-28H,5-7,12H2,1-4H3,(H,22,26)(H,23,25)/t14-,17-,18+/m1/s1 |
| InChIKey | YFCYGFAUVOMHFH-OLMNPRSZSA-N |
| XLogP | 0.98 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|