C20H24N2O4 — CID 59417442
N-[(3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide (PubChem CID 59417442) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide.
| Compound Name | N-[(3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 59417442 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[(3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-(4-methylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(CCc2ccc(C(=O)NC(C(=O)NO)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-13-3-5-15(6-4-13)7-8-16-9-11-17(12-10-16)19(24)21-18(14(2)23)20(25)22-26/h3-6,9-12,14,18,23,26H,7-8H2,1-2H3,(H,21,24)(H,22,25)/t14-,18?/m1/s1 |
| InChIKey | WOJIPTKYUHMWSL-IKJXHCRLSA-N |
| XLogP | 1.76 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|