C23H29N3O5 — CID 59829953
4-(4-ethylphenyl)-N-[(2S)-1-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]benzamide (PubChem CID 59829953) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-N-[(2S)-1-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-(4-ethylphenyl)-N-[(2S)-1-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59829953 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 4-(4-ethylphenyl)-N-[(2S)-1-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]benzamide |
| SMILES | CCc1ccc(-c2ccc(C(=O)N[C@@H](CC)C(=O)N[C@H](C(=O)NO)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O5/c1-4-15-6-8-16(9-7-15)17-10-12-18(13-11-17)21(28)24-19(5-2)22(29)25-20(14(3)27)23(30)26-31/h6-14,19-20,27,31H,4-5H2,1-3H3,(H,24,28)(H,25,29)(H,26,30)/t14-,19+,20+/m1/s1 |
| InChIKey | QLQJYNVWJCJSIT-UAOJZALGSA-N |
| XLogP | 1.80 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|