C20H22N2O5 — CID 89219792
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[(E)-2-[4-(hydroxymethyl)phenyl]ethenyl]benzamide (PubChem CID 89219792) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[(E)-2-[4-(hydroxymethyl)phenyl]ethenyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[(E)-2-[4-(hydroxymethyl)phenyl]ethenyl]benzamide |
|---|---|
| PubChem CID | 89219792 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[(E)-2-[4-(hydroxymethyl)phenyl]ethenyl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(/C=C/c2ccc(CO)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H22N2O5/c1-13(24)18(20(26)22-27)21-19(25)17-10-8-15(9-11-17)3-2-14-4-6-16(12-23)7-5-14/h2-11,13,18,23-24,27H,12H2,1H3,(H,21,25)(H,22,26)/b3-2+/t13-,18+/m1/s1 |
| InChIKey | NHFNYTOMCMUYFV-QQTWAJAKSA-N |
| XLogP | 1.33 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|