C19H20N2O5 — CID 139401652
4-[(1E,3E)-4-(furan-3-yl)buta-1,3-dienyl]-N-[(3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 139401652) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(furan-3-yl)buta-1,3-dienyl]-N-[(3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[(1E,3E)-4-(furan-3-yl)buta-1,3-dienyl]-N-[(3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 139401652 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[(1E,3E)-4-(furan-3-yl)buta-1,3-dienyl]-N-[(3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](O)C(NC(=O)c1ccc(/C=C/C=C/c2ccoc2)cc1)C(=O)NO |
| InChI | InChI=1S/C19H20N2O5/c1-13(22)17(19(24)21-25)20-18(23)16-8-6-14(7-9-16)4-2-3-5-15-10-11-26-12-15/h2-13,17,22,25H,1H3,(H,20,23)(H,21,24)/b4-2+,5-3+/t13-,17?/m1/s1 |
| InChIKey | JWLNZFJGKSYULK-LXDFBMDTSA-N |
| XLogP | 1.99 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|